C11H22BrN3 — CID 177251619
[dimethylamino-(hexa-1,5-dien-3-ylamino)methylidene]-dimethylazanium bromide (PubChem CID 177251619) has the molecular formula C11H22BrN3 and a molecular weight of 276.22 g/mol. Its IUPAC name is [dimethylamino-(hexa-1,5-dien-3-ylamino)methylidene]-dimethylazanium bromide.
| Compound Name | [dimethylamino-(hexa-1,5-dien-3-ylamino)methylidene]-dimethylazanium bromide |
|---|---|
| PubChem CID | 177251619 |
| Molecular Formula | C11H22BrN3 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | [dimethylamino-(hexa-1,5-dien-3-ylamino)methylidene]-dimethylazanium bromide |
| SMILES | C=CCC(C=C)NC(N(C)C)=[N+](C)C.[Br-] |
| InChI | InChI=1S/C11H21N3.BrH/c1-7-9-10(8-2)12-11(13(3)4)14(5)6;/h7-8,10H,1-2,9H2,3-6H3;1H |
| InChIKey | DZFWZNYDMARIFZ-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|