C12H24FN3 — CID 109498332
3-ethyl-2-(3-fluoropropyl)-1-methyl-1-pent-4-enylguanidine (PubChem CID 109498332) has the molecular formula C12H24FN3 and a molecular weight of 229.34 g/mol. Its IUPAC name is 3-ethyl-2-(3-fluoropropyl)-1-methyl-1-pent-4-enylguanidine.
| Compound Name | 3-ethyl-2-(3-fluoropropyl)-1-methyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109498332 |
| Molecular Formula | C12H24FN3 |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 3-ethyl-2-(3-fluoropropyl)-1-methyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\CCCF)NCC |
| InChI | InChI=1S/C12H24FN3/c1-4-6-7-11-16(3)12(14-5-2)15-10-8-9-13/h4H,1,5-11H2,2-3H3,(H,14,15) |
| InChIKey | WJLYREJJEGAGIY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|