C12H23F2N3 — CID 109483769
3-(2,2-difluoroethyl)-1-hept-6-enyl-1,2-dimethylguanidine (PubChem CID 109483769) has the molecular formula C12H23F2N3 and a molecular weight of 247.33 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-1-hept-6-enyl-1,2-dimethylguanidine.
| Compound Name | 3-(2,2-difluoroethyl)-1-hept-6-enyl-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109483769 |
| Molecular Formula | C12H23F2N3 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 3-(2,2-difluoroethyl)-1-hept-6-enyl-1,2-dimethylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N/C)NCC(F)F |
| InChI | InChI=1S/C12H23F2N3/c1-4-5-6-7-8-9-17(3)12(15-2)16-10-11(13)14/h4,11H,1,5-10H2,2-3H3,(H,15,16) |
| InChIKey | YSTUWWVXOMQIBV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|