C13H25F2N3 — CID 109483559
2-(2,2-difluoroethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine (PubChem CID 109483559) has the molecular formula C13H25F2N3 and a molecular weight of 261.36 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine.
| Compound Name | 2-(2,2-difluoroethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine |
|---|---|
| PubChem CID | 109483559 |
| Molecular Formula | C13H25F2N3 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 2-(2,2-difluoroethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N\CC(F)F)NCC |
| InChI | InChI=1S/C13H25F2N3/c1-4-6-7-8-9-10-18(3)13(16-5-2)17-11-12(14)15/h4,12H,1,5-11H2,2-3H3,(H,16,17) |
| InChIKey | SQAWEZLBYCJRDK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|