C15H28F3N3O — CID 109482909
1-hept-6-enyl-1,2-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 109482909) has the molecular formula C15H28F3N3O and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-hept-6-enyl-1,2-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 1-hept-6-enyl-1,2-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 109482909 |
| Molecular Formula | C15H28F3N3O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 1-hept-6-enyl-1,2-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | C=CCCCCCN(C)/C(=N/C)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C15H28F3N3O/c1-4-5-6-7-8-11-21(3)14(19-2)20-10-9-12-22-13-15(16,17)18/h4H,1,5-13H2,2-3H3,(H,19,20) |
| InChIKey | GCUZDGDPGXKTBL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|