C15H28F3N3 — CID 109484215
1-hept-6-enyl-1,2-dimethyl-3-(5,5,5-trifluoropentyl)guanidine (PubChem CID 109484215) has the molecular formula C15H28F3N3 and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-hept-6-enyl-1,2-dimethyl-3-(5,5,5-trifluoropentyl)guanidine.
| Compound Name | 1-hept-6-enyl-1,2-dimethyl-3-(5,5,5-trifluoropentyl)guanidine |
|---|---|
| PubChem CID | 109484215 |
| Molecular Formula | C15H28F3N3 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | 1-hept-6-enyl-1,2-dimethyl-3-(5,5,5-trifluoropentyl)guanidine |
| SMILES | C=CCCCCCN(C)/C(=N/C)NCCCCC(F)(F)F |
| InChI | InChI=1S/C15H28F3N3/c1-4-5-6-7-10-13-21(3)14(19-2)20-12-9-8-11-15(16,17)18/h4H,1,5-13H2,2-3H3,(H,19,20) |
| InChIKey | PPEOUOOMHZGAKF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|