C14H26F3N3 — CID 109496894
3-ethyl-1-methyl-1-pent-4-enyl-2-(5,5,5-trifluoropentyl)guanidine (PubChem CID 109496894) has the molecular formula C14H26F3N3 and a molecular weight of 293.38 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-pent-4-enyl-2-(5,5,5-trifluoropentyl)guanidine.
| Compound Name | 3-ethyl-1-methyl-1-pent-4-enyl-2-(5,5,5-trifluoropentyl)guanidine |
|---|---|
| PubChem CID | 109496894 |
| Molecular Formula | C14H26F3N3 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 3-ethyl-1-methyl-1-pent-4-enyl-2-(5,5,5-trifluoropentyl)guanidine |
| SMILES | C=CCCCN(C)/C(=N\CCCCC(F)(F)F)NCC |
| InChI | InChI=1S/C14H26F3N3/c1-4-6-9-12-20(3)13(18-5-2)19-11-8-7-10-14(15,16)17/h4H,1,5-12H2,2-3H3,(H,18,19) |
| InChIKey | DSZSGXULRMDGQN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|