C11H22FN3 — CID 109499214
3-(3-fluoropropyl)-1,2-dimethyl-1-pent-4-enylguanidine (PubChem CID 109499214) has the molecular formula C11H22FN3 and a molecular weight of 215.32 g/mol. Its IUPAC name is 3-(3-fluoropropyl)-1,2-dimethyl-1-pent-4-enylguanidine.
| Compound Name | 3-(3-fluoropropyl)-1,2-dimethyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109499214 |
| Molecular Formula | C11H22FN3 |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.18 |
| IUPAC Name | 3-(3-fluoropropyl)-1,2-dimethyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N/C)NCCCF |
| InChI | InChI=1S/C11H22FN3/c1-4-5-6-10-15(3)11(13-2)14-9-7-8-12/h4H,1,5-10H2,2-3H3,(H,13,14) |
| InChIKey | QWSZKCYRRWWAKH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|