C11H22N4 — CID 152619293
4-N,4-diethyl-6-propyl-1H-pyrimidine-2,4-diamine (PubChem CID 152619293) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-N,4-diethyl-6-propyl-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-N,4-diethyl-6-propyl-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 152619293 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 4-N,4-diethyl-6-propyl-1H-pyrimidine-2,4-diamine |
| SMILES | CCCC1=CC(CC)(NCC)N=C(N)N1 |
| InChI | InChI=1S/C11H22N4/c1-4-7-9-8-11(5-2,13-6-3)15-10(12)14-9/h8,13H,4-7H2,1-3H3,(H3,12,14,15) |
| InChIKey | ZBEIYOTWBJQULU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |