C13H23N5 — CID 163762524
N'-[amino-[(3-methylcyclohexa-1,3-dien-1-yl)amino]methyl]pyrrolidine-1-carboximidamide (PubChem CID 163762524) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is N'-[amino-[(3-methylcyclohexa-1,3-dien-1-yl)amino]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-[amino-[(3-methylcyclohexa-1,3-dien-1-yl)amino]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 163762524 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | N'-[amino-[(3-methylcyclohexa-1,3-dien-1-yl)amino]methyl]pyrrolidine-1-carboximidamide |
| SMILES | CC1=CCCC(NC(N)N=C(N)N2CCCC2)=C1 |
| InChI | InChI=1S/C13H23N5/c1-10-5-4-6-11(9-10)16-12(14)17-13(15)18-7-2-3-8-18/h5,9,12,16H,2-4,6-8,14H2,1H3,(H2,15,17) |
| InChIKey | LZKNFIQBKBMMBM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|