C9H16N4 — CID 163464507
1-(3-amino-6-methylcyclohexa-2,4-dien-1-yl)-2-methylguanidine (PubChem CID 163464507) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(3-amino-6-methylcyclohexa-2,4-dien-1-yl)-2-methylguanidine.
| Compound Name | 1-(3-amino-6-methylcyclohexa-2,4-dien-1-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 163464507 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 1-(3-amino-6-methylcyclohexa-2,4-dien-1-yl)-2-methylguanidine |
| SMILES | C/N=C(\N)NC1C=C(N)C=CC1C |
| InChI | InChI=1S/C9H16N4/c1-6-3-4-7(10)5-8(6)13-9(11)12-2/h3-6,8H,10H2,1-2H3,(H3,11,12,13) |
| InChIKey | BRJRJQRRBJNHOR-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|