C13H19N4+ — CID 163793391
N-[4-(1H-imidazol-1-ium-4-yl)cyclohexa-1,5-dien-1-yl]-N'-propan-2-ylmethanimidamide (PubChem CID 163793391) has the molecular formula C13H19N4+ and a molecular weight of 231.32 g/mol. Its IUPAC name is N-[4-(1H-imidazol-1-ium-4-yl)cyclohexa-1,5-dien-1-yl]-N'-propan-2-ylmethanimidamide.
| Compound Name | N-[4-(1H-imidazol-1-ium-4-yl)cyclohexa-1,5-dien-1-yl]-N'-propan-2-ylmethanimidamide |
|---|---|
| PubChem CID | 163793391 |
| Molecular Formula | C13H19N4+ |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-[4-(1H-imidazol-1-ium-4-yl)cyclohexa-1,5-dien-1-yl]-N'-propan-2-ylmethanimidamide |
| SMILES | CC(C)/N=C/NC1=CCC(C2=C[NH2+]C=N2)C=C1 |
| InChI | InChI=1S/C13H18N4/c1-10(2)15-9-16-12-5-3-11(4-6-12)13-7-14-8-17-13/h3,5-11H,4H2,1-2H3,(H,14,17)(H,15,16)/p+1 |
| InChIKey | MYSWJXMHMABULK-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 53.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|