C9H14N2 — CID 163745590
6-[(1Z)-buta-1,3-dienyl]-5-methyl-1,4,5,6-tetrahydropyrimidine (PubChem CID 163745590) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 6-[(1Z)-buta-1,3-dienyl]-5-methyl-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 6-[(1Z)-buta-1,3-dienyl]-5-methyl-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 163745590 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 6-[(1Z)-buta-1,3-dienyl]-5-methyl-1,4,5,6-tetrahydropyrimidine |
| SMILES | C=C/C=C\C1NC=NCC1C |
| InChI | InChI=1S/C9H14N2/c1-3-4-5-9-8(2)6-10-7-11-9/h3-5,7-9H,1,6H2,2H3,(H,10,11)/b5-4- |
| InChIKey | LLORQPYHUZZLEG-PLNGDYQASA-N |
| XLogP | 1.36 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|