C9H12N2S — CID 19894656
2-methylsulfanyl-1,4,4a,8a-tetrahydroquinazoline (PubChem CID 19894656) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is 2-methylsulfanyl-1,4,4a,8a-tetrahydroquinazoline.
| Compound Name | 2-methylsulfanyl-1,4,4a,8a-tetrahydroquinazoline |
|---|---|
| PubChem CID | 19894656 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 2-methylsulfanyl-1,4,4a,8a-tetrahydroquinazoline |
| SMILES | CSC1=NCC2C=CC=CC2N1 |
| InChI | InChI=1S/C9H12N2S/c1-12-9-10-6-7-4-2-3-5-8(7)11-9/h2-5,7-8H,6H2,1H3,(H,10,11) |
| InChIKey | GTZBRSUSVPGNRV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |