C9H12N2 — CID 91364002
4,4a,9,9a-tetrahydro-1H-cyclohepta[d]pyrimidine (PubChem CID 91364002) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 4,4a,9,9a-tetrahydro-1H-cyclohepta[d]pyrimidine.
| Compound Name | 4,4a,9,9a-tetrahydro-1H-cyclohepta[d]pyrimidine |
|---|---|
| PubChem CID | 91364002 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 4,4a,9,9a-tetrahydro-1H-cyclohepta[d]pyrimidine |
| SMILES | C1=CCC2NC=NCC2C=C1 |
| InChI | InChI=1S/C9H12N2/c1-2-4-8-6-10-7-11-9(8)5-3-1/h1-4,7-9H,5-6H2,(H,10,11) |
| InChIKey | ZAFGCBHHHNJEPC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |