C11H17N3 — CID 143159911
N'-methyl-N-[(3Z,5E,8Z)-7-methyl-2,7-dihydro-1H-azonin-5-yl]methanimidamide (PubChem CID 143159911) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N'-methyl-N-[(3Z,5E,8Z)-7-methyl-2,7-dihydro-1H-azonin-5-yl]methanimidamide.
| Compound Name | N'-methyl-N-[(3Z,5E,8Z)-7-methyl-2,7-dihydro-1H-azonin-5-yl]methanimidamide |
|---|---|
| PubChem CID | 143159911 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N'-methyl-N-[(3Z,5E,8Z)-7-methyl-2,7-dihydro-1H-azonin-5-yl]methanimidamide |
| SMILES | C/N=C/NC1=C/C(C)/C=C\NC/C=C\1 |
| InChI | InChI=1S/C11H17N3/c1-10-5-7-13-6-3-4-11(8-10)14-9-12-2/h3-5,7-10,13H,6H2,1-2H3,(H,12,14)/b4-3-,7-5-,11-8+ |
| InChIKey | OMNBTCHMKVSJRN-AOYOVMBCSA-N |
| XLogP | 1.43 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|