C10H16N2 — CID 91573404
5-propan-2-yl-4,9-dihydro-1H-1,3-diazonine (PubChem CID 91573404) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 5-propan-2-yl-4,9-dihydro-1H-1,3-diazonine.
| Compound Name | 5-propan-2-yl-4,9-dihydro-1H-1,3-diazonine |
|---|---|
| PubChem CID | 91573404 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 5-propan-2-yl-4,9-dihydro-1H-1,3-diazonine |
| SMILES | CC(C)C1=CC=CCN/C=N\C1 |
| InChI | InChI=1S/C10H16N2/c1-9(2)10-5-3-4-6-11-8-12-7-10/h3-5,8-9H,6-7H2,1-2H3,(H,11,12) |
| InChIKey | AARKRYSWWYFQSY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |