C10H20N4 — CID 176971990
(4E)-4-[(5E)-5-(aminomethylidene)-1H-imidazol-4-ylidene]butan-2-amine;ethane (PubChem CID 176971990) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is (4E)-4-[(5E)-5-(aminomethylidene)-1H-imidazol-4-ylidene]butan-2-amine;ethane.
| Compound Name | (4E)-4-[(5E)-5-(aminomethylidene)-1H-imidazol-4-ylidene]butan-2-amine;ethane |
|---|---|
| PubChem CID | 176971990 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | (4E)-4-[(5E)-5-(aminomethylidene)-1H-imidazol-4-ylidene]butan-2-amine;ethane |
| SMILES | CC.CC(N)C/C=c1/nc[nH]/c1=C/N |
| InChI | InChI=1S/C8H14N4.C2H6/c1-6(10)2-3-7-8(4-9)12-5-11-7;1-2/h3-6H,2,9-10H2,1H3,(H,11,12);1-2H3/b7-3+,8-4+; |
| InChIKey | XMYZEEBFZYAODB-UQXJJJGTSA-N |
| XLogP | -0.35 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |