C9H14N2 — CID 145267144
5,6-dihydro-1H-benzimidazole;ethane (PubChem CID 145267144) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 5,6-dihydro-1H-benzimidazole;ethane.
| Compound Name | 5,6-dihydro-1H-benzimidazole;ethane |
|---|---|
| PubChem CID | 145267144 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 5,6-dihydro-1H-benzimidazole;ethane |
| SMILES | C1=c2nc[nH]c2=CCC1.CC |
| InChI | InChI=1S/C7H8N2.C2H6/c1-2-4-7-6(3-1)8-5-9-7;1-2/h3-5H,1-2H2,(H,8,9);1-2H3 |
| InChIKey | WBEGCNKKBODENU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |