C11H20N2 — CID 154679318
N'-ethyl-N-[(3Z,5E)-2-methylhepta-3,5-dien-3-yl]methanimidamide (PubChem CID 154679318) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is N'-ethyl-N-[(3Z,5E)-2-methylhepta-3,5-dien-3-yl]methanimidamide.
| Compound Name | N'-ethyl-N-[(3Z,5E)-2-methylhepta-3,5-dien-3-yl]methanimidamide |
|---|---|
| PubChem CID | 154679318 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N'-ethyl-N-[(3Z,5E)-2-methylhepta-3,5-dien-3-yl]methanimidamide |
| SMILES | C/C=C/C=C(\N/C=N/CC)C(C)C |
| InChI | InChI=1S/C11H20N2/c1-5-7-8-11(10(3)4)13-9-12-6-2/h5,7-10H,6H2,1-4H3,(H,12,13)/b7-5+,11-8- |
| InChIKey | HPBHRBDAKWBYHB-BFPPUAHJSA-N |
| XLogP | 2.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|