About 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide
4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide (PubChem CID 89170048) has the molecular formula C11H20N4
and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide.
Molecular Properties
| Compound Name | 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide |
| PubChem CID | 89170048 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide |
| SMILES | C=C/C=C(C)\N=C(/N)N1CCN(C)CC1 |
| InChI | InChI=1S/C11H20N4/c1-4-5-10(2)13-11(12)15-8-6-14(3)7-9-15/h4-5H,1,6-9H2,2-3H3,(H2,12,13)/b10-5- |
| InChIKey | MVBMRGIPONADIQ-YHYXMXQVSA-N |
| XLogP | 0.64 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide?
The IUPAC name of 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide (CID 89170048) is 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide.
What is the SMILES notation for 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide?
The canonical SMILES for 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide is C=C/C=C(C)\N=C(/N)N1CCN(C)CC1.
What is the InChIKey of 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide?
The InChIKey is MVBMRGIPONADIQ-YHYXMXQVSA-N. The full InChI is InChI=1S/C11H20N4/c1-4-5-10(2)13-11(12)15-8-6-14(3)7-9-15/h4-5H,1,6-9H2,2-3H3,(H2,12,13)/b10-5-.
What are the key properties of 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide?
4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide has a molecular weight of 208.31 g/mol, XLogP of 0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide is sourced from PubChem (CID 89170048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).