C11H20N4 — CID 89170048
4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide (PubChem CID 89170048) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide.
| Compound Name | 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 89170048 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 4-methyl-N'-[(2Z)-penta-2,4-dien-2-yl]piperazine-1-carboximidamide |
| SMILES | C=C/C=C(C)\N=C(/N)N1CCN(C)CC1 |
| InChI | InChI=1S/C11H20N4/c1-4-5-10(2)13-11(12)15-8-6-14(3)7-9-15/h4-5H,1,6-9H2,2-3H3,(H2,12,13)/b10-5- |
| InChIKey | MVBMRGIPONADIQ-YHYXMXQVSA-N |
| XLogP | 0.64 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|