C13H24N4 — CID 89170042
4-(dimethylamino)-N'-[(2Z)-penta-2,4-dien-2-yl]piperidine-1-carboximidamide (PubChem CID 89170042) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 4-(dimethylamino)-N'-[(2Z)-penta-2,4-dien-2-yl]piperidine-1-carboximidamide.
| Compound Name | 4-(dimethylamino)-N'-[(2Z)-penta-2,4-dien-2-yl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 89170042 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 4-(dimethylamino)-N'-[(2Z)-penta-2,4-dien-2-yl]piperidine-1-carboximidamide |
| SMILES | C=C/C=C(C)\N=C(/N)N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C13H24N4/c1-5-6-11(2)15-13(14)17-9-7-12(8-10-17)16(3)4/h5-6,12H,1,7-10H2,2-4H3,(H2,14,15)/b11-6- |
| InChIKey | VIWZSIRUBPKXOJ-WDZFZDKYSA-N |
| XLogP | 1.42 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|