C12H24N4 — CID 134406903
(1E,3Z)-1-[4-(dimethylamino)piperidin-1-yl]penta-1,3-diene-1,4-diamine (PubChem CID 134406903) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is (1E,3Z)-1-[4-(dimethylamino)piperidin-1-yl]penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-[4-(dimethylamino)piperidin-1-yl]penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 134406903 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | (1E,3Z)-1-[4-(dimethylamino)piperidin-1-yl]penta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C12H24N4/c1-10(13)4-5-12(14)16-8-6-11(7-9-16)15(2)3/h4-5,11H,6-9,13-14H2,1-3H3/b10-4-,12-5+ |
| InChIKey | RALZQORJUJQGDA-JUIRWTBGSA-N |
| XLogP | 0.68 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|