C11H23N3O — CID 145197855
1-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]pyrrolidin-3-ol;ethane (PubChem CID 145197855) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]pyrrolidin-3-ol;ethane.
| Compound Name | 1-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]pyrrolidin-3-ol;ethane |
|---|---|
| PubChem CID | 145197855 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 1-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]pyrrolidin-3-ol;ethane |
| SMILES | C/C(N)=C/C=C(\N)N1CCC(O)C1.CC |
| InChI | InChI=1S/C9H17N3O.C2H6/c1-7(10)2-3-9(11)12-5-4-8(13)6-12;1-2/h2-3,8,13H,4-6,10-11H2,1H3;1-2H3/b7-2-,9-3+; |
| InChIKey | KCUPZKJZQHWELD-LUROCKLQSA-N |
| XLogP | 0.74 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|