C12H23N3O — CID 145198105
1-[(1E,3Z)-1,4-diamino-5-methylhexa-1,3-dienyl]piperidin-3-ol (PubChem CID 145198105) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-[(1E,3Z)-1,4-diamino-5-methylhexa-1,3-dienyl]piperidin-3-ol.
| Compound Name | 1-[(1E,3Z)-1,4-diamino-5-methylhexa-1,3-dienyl]piperidin-3-ol |
|---|---|
| PubChem CID | 145198105 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 1-[(1E,3Z)-1,4-diamino-5-methylhexa-1,3-dienyl]piperidin-3-ol |
| SMILES | CC(C)/C(N)=C/C=C(\N)N1CCCC(O)C1 |
| InChI | InChI=1S/C12H23N3O/c1-9(2)11(13)5-6-12(14)15-7-3-4-10(16)8-15/h5-6,9-10,16H,3-4,7-8,13-14H2,1-2H3/b11-5-,12-6+ |
| InChIKey | NXZGEPYNSVEQAM-JTAXDKCCSA-N |
| XLogP | 0.74 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|