C13H25N3O — CID 134406343
1-[(1E,3Z)-1,4-diamino-5,5-dimethylhexa-1,3-dienyl]piperidin-3-ol (PubChem CID 134406343) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-[(1E,3Z)-1,4-diamino-5,5-dimethylhexa-1,3-dienyl]piperidin-3-ol.
| Compound Name | 1-[(1E,3Z)-1,4-diamino-5,5-dimethylhexa-1,3-dienyl]piperidin-3-ol |
|---|---|
| PubChem CID | 134406343 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 1-[(1E,3Z)-1,4-diamino-5,5-dimethylhexa-1,3-dienyl]piperidin-3-ol |
| SMILES | CC(C)(C)/C(N)=C/C=C(\N)N1CCCC(O)C1 |
| InChI | InChI=1S/C13H25N3O/c1-13(2,3)11(14)6-7-12(15)16-8-4-5-10(17)9-16/h6-7,10,17H,4-5,8-9,14-15H2,1-3H3/b11-6-,12-7+ |
| InChIKey | RLIMOMJIYGHTSJ-TWTKIJFOSA-N |
| XLogP | 1.13 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|