C11H20N4O2 — CID 134406837
[1-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]piperidin-3-yl]-nitrosomethanol (PubChem CID 134406837) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is [1-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]piperidin-3-yl]-nitrosomethanol.
| Compound Name | [1-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]piperidin-3-yl]-nitrosomethanol |
|---|---|
| PubChem CID | 134406837 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | [1-[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]piperidin-3-yl]-nitrosomethanol |
| SMILES | C/C(N)=C/C=C(\N)N1CCCC(C(O)N=O)C1 |
| InChI | InChI=1S/C11H20N4O2/c1-8(12)4-5-10(13)15-6-2-3-9(7-15)11(16)14-17/h4-5,9,11,16H,2-3,6-7,12-13H2,1H3/b8-4-,10-5+ |
| InChIKey | VVLAZSYXKUTHGE-HZEUFOEUSA-N |
| XLogP | 0.45 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|