C13H28N4 — CID 145198026
(1E,3Z)-1-(4-amino-3-methylpiperidin-1-yl)penta-1,3-diene-1,4-diamine;ethane (PubChem CID 145198026) has the molecular formula C13H28N4 and a molecular weight of 240.39 g/mol. Its IUPAC name is (1E,3Z)-1-(4-amino-3-methylpiperidin-1-yl)penta-1,3-diene-1,4-diamine;ethane.
| Compound Name | (1E,3Z)-1-(4-amino-3-methylpiperidin-1-yl)penta-1,3-diene-1,4-diamine;ethane |
|---|---|
| PubChem CID | 145198026 |
| Molecular Formula | C13H28N4 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.23 |
| IUPAC Name | (1E,3Z)-1-(4-amino-3-methylpiperidin-1-yl)penta-1,3-diene-1,4-diamine;ethane |
| SMILES | C/C(N)=C/C=C(\N)N1CCC(N)C(C)C1.CC |
| InChI | InChI=1S/C11H22N4.C2H6/c1-8-7-15(6-5-10(8)13)11(14)4-3-9(2)12;1-2/h3-4,8,10H,5-7,12-14H2,1-2H3;1-2H3/b9-3-,11-4+; |
| InChIKey | GUVKSHMFFWXTBT-BPMLPNQQSA-N |
| XLogP | 1.34 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|