C12H20N2O — CID 79879745
1-(4-amino-3-methylpiperidin-1-yl)hexa-2,4-dien-1-one (PubChem CID 79879745) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-(4-amino-3-methylpiperidin-1-yl)hexa-2,4-dien-1-one.
| Compound Name | 1-(4-amino-3-methylpiperidin-1-yl)hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 79879745 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(4-amino-3-methylpiperidin-1-yl)hexa-2,4-dien-1-one |
| SMILES | CC=CC=CC(=O)N1CCC(N)C(C)C1 |
| InChI | InChI=1S/C12H20N2O/c1-3-4-5-6-12(15)14-8-7-11(13)10(2)9-14/h3-6,10-11H,7-9,13H2,1-2H3 |
| InChIKey | ISORDOUMTFCKJF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|