C12H17NO3 — CID 81119200
(3R)-1-[(4E)-hexa-2,4-dienoyl]piperidine-3-carboxylic acid (PubChem CID 81119200) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (3R)-1-[(4E)-hexa-2,4-dienoyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(4E)-hexa-2,4-dienoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81119200 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (3R)-1-[(4E)-hexa-2,4-dienoyl]piperidine-3-carboxylic acid |
| SMILES | C/C=C/C=CC(=O)N1CCC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C12H17NO3/c1-2-3-4-7-11(14)13-8-5-6-10(9-13)12(15)16/h2-4,7,10H,5-6,8-9H2,1H3,(H,15,16)/b3-2+,7-4?/t10-/m1/s1 |
| InChIKey | YPFDEUDSRQRFRU-GOTJIHEXSA-N |
| XLogP | 1.44 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|