C11H18N2O — CID 82234986
(2E,4E)-1-(3-aminopiperidin-1-yl)hexa-2,4-dien-1-one (PubChem CID 82234986) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (2E,4E)-1-(3-aminopiperidin-1-yl)hexa-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-(3-aminopiperidin-1-yl)hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 82234986 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (2E,4E)-1-(3-aminopiperidin-1-yl)hexa-2,4-dien-1-one |
| SMILES | C/C=C/C=C/C(=O)N1CCCC(N)C1 |
| InChI | InChI=1S/C11H18N2O/c1-2-3-4-7-11(14)13-8-5-6-10(12)9-13/h2-4,7,10H,5-6,8-9,12H2,1H3/b3-2+,7-4+ |
| InChIKey | OQYMDGNIFIPDCK-AOGGBPEJSA-N |
| XLogP | 1.07 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|