About 1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane
1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane (PubChem CID 172623481) has the molecular formula C9H17FN2O
and a molecular weight of 188.25 g/mol. Its IUPAC name is 1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane.
Molecular Properties
| Compound Name | 1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane |
| PubChem CID | 172623481 |
| Molecular Formula | C9H17FN2O |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane |
| SMILES | C=CC(=O)N1CCCC(N)C1.CF |
| InChI | InChI=1S/C8H14N2O.CH3F/c1-2-8(11)10-5-3-4-7(9)6-10;1-2/h2,7H,1,3-6,9H2;1H3 |
| InChIKey | UNWSMKZYVBISSY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane?
The IUPAC name of 1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane (CID 172623481) is 1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane.
What is the SMILES notation for 1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane?
The canonical SMILES for 1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane is C=CC(=O)N1CCCC(N)C1.CF.
What is the InChIKey of 1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane?
The InChIKey is UNWSMKZYVBISSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O.CH3F/c1-2-8(11)10-5-3-4-7(9)6-10;1-2/h2,7H,1,3-6,9H2;1H3.
What are the key properties of 1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane?
1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane has a molecular weight of 188.25 g/mol, XLogP of 0.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-aminopiperidin-1-yl)prop-2-en-1-one;fluoromethane is sourced from PubChem (CID 172623481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).