C11H20N2O — CID 77015507
1-[3-(2-aminoethyl)piperidin-1-yl]but-2-en-1-one (PubChem CID 77015507) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-[3-(2-aminoethyl)piperidin-1-yl]but-2-en-1-one.
| Compound Name | 1-[3-(2-aminoethyl)piperidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 77015507 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-[3-(2-aminoethyl)piperidin-1-yl]but-2-en-1-one |
| SMILES | CC=CC(=O)N1CCCC(CCN)C1 |
| InChI | InChI=1S/C11H20N2O/c1-2-4-11(14)13-8-3-5-10(9-13)6-7-12/h2,4,10H,3,5-9,12H2,1H3 |
| InChIKey | AROZQYIPQSTNPF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|