C8H14N2OS — CID 131234158
(E)-1-[(3R)-3-aminopyrrolidin-1-yl]-3-methylsulfanylprop-2-en-1-one (PubChem CID 131234158) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is (E)-1-[(3R)-3-aminopyrrolidin-1-yl]-3-methylsulfanylprop-2-en-1-one.
| Compound Name | (E)-1-[(3R)-3-aminopyrrolidin-1-yl]-3-methylsulfanylprop-2-en-1-one |
|---|---|
| PubChem CID | 131234158 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | (E)-1-[(3R)-3-aminopyrrolidin-1-yl]-3-methylsulfanylprop-2-en-1-one |
| SMILES | CS/C=C/C(=O)N1CC[C@@H](N)C1 |
| InChI | InChI=1S/C8H14N2OS/c1-12-5-3-8(11)10-4-2-7(9)6-10/h3,5,7H,2,4,6,9H2,1H3/b5-3+/t7-/m1/s1 |
| InChIKey | WNAUQYHDSCXRJY-OHCKJTPYSA-N |
| XLogP | 0.42 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|