C12H23F3N4 — CID 145197589
ethane;(1E,3Z)-1-[3-(trifluoromethyl)piperazin-1-yl]penta-1,3-diene-1,4-diamine (PubChem CID 145197589) has the molecular formula C12H23F3N4 and a molecular weight of 280.34 g/mol. Its IUPAC name is ethane;(1E,3Z)-1-[3-(trifluoromethyl)piperazin-1-yl]penta-1,3-diene-1,4-diamine.
| Compound Name | ethane;(1E,3Z)-1-[3-(trifluoromethyl)piperazin-1-yl]penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 145197589 |
| Molecular Formula | C12H23F3N4 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | ethane;(1E,3Z)-1-[3-(trifluoromethyl)piperazin-1-yl]penta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)N1CCNC(C(F)(F)F)C1.CC |
| InChI | InChI=1S/C10H17F3N4.C2H6/c1-7(14)2-3-9(15)17-5-4-16-8(6-17)10(11,12)13;1-2/h2-3,8,16H,4-6,14-15H2,1H3;1-2H3/b7-2-,9-3+; |
| InChIKey | FFPATWFXKDTECG-LUROCKLQSA-N |
| XLogP | 1.51 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|