C10H17F3N4 — CID 178030376
(3E)-4-[3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]buta-1,3-diene-1,1,4-triamine (PubChem CID 178030376) has the molecular formula C10H17F3N4 and a molecular weight of 250.27 g/mol. Its IUPAC name is (3E)-4-[3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]buta-1,3-diene-1,1,4-triamine.
| Compound Name | (3E)-4-[3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]buta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 178030376 |
| Molecular Formula | C10H17F3N4 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (3E)-4-[3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]buta-1,3-diene-1,1,4-triamine |
| SMILES | NC(N)=C/C=C(\N)N1CCC(CC(F)(F)F)C1 |
| InChI | InChI=1S/C10H17F3N4/c11-10(12,13)5-7-3-4-17(6-7)9(16)2-1-8(14)15/h1-2,7H,3-6,14-16H2/b9-2+ |
| InChIKey | SHIFMYODBHVKRW-XNWCZRBMSA-N |
| XLogP | 0.82 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|