C9H13ClF3NO — CID 114801279
1-[3-(2-chloroethyl)pyrrolidin-1-yl]-3,3,3-trifluoropropan-1-one (PubChem CID 114801279) has the molecular formula C9H13ClF3NO and a molecular weight of 243.66 g/mol. Its IUPAC name is 1-[3-(2-chloroethyl)pyrrolidin-1-yl]-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-[3-(2-chloroethyl)pyrrolidin-1-yl]-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 114801279 |
| Molecular Formula | C9H13ClF3NO |
| Molecular Weight | 243.66 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 1-[3-(2-chloroethyl)pyrrolidin-1-yl]-3,3,3-trifluoropropan-1-one |
| SMILES | O=C(CC(F)(F)F)N1CCC(CCCl)C1 |
| InChI | InChI=1S/C9H13ClF3NO/c10-3-1-7-2-4-14(6-7)8(15)5-9(11,12)13/h7H,1-6H2 |
| InChIKey | QRSBTCNPMZFBEX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.66 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|