C8H13F3N2O — CID 16776828
1-(4-aminopiperidin-1-yl)-3,3,3-trifluoropropan-1-one (PubChem CID 16776828) has the molecular formula C8H13F3N2O and a molecular weight of 210.20 g/mol. Its IUPAC name is 1-(4-aminopiperidin-1-yl)-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-(4-aminopiperidin-1-yl)-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 16776828 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1-(4-aminopiperidin-1-yl)-3,3,3-trifluoropropan-1-one |
| SMILES | NC1CCN(C(=O)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C8H13F3N2O/c9-8(10,11)5-7(14)13-3-1-6(12)2-4-13/h6H,1-5,12H2 |
| InChIKey | XVECYUUVEDNTHB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |