C7H9ClF3NO — CID 63397799
1-(3-chloropyrrolidin-1-yl)-3,3,3-trifluoropropan-1-one (PubChem CID 63397799) has the molecular formula C7H9ClF3NO and a molecular weight of 215.60 g/mol. Its IUPAC name is 1-(3-chloropyrrolidin-1-yl)-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-(3-chloropyrrolidin-1-yl)-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 63397799 |
| Molecular Formula | C7H9ClF3NO |
| Molecular Weight | 215.60 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 1-(3-chloropyrrolidin-1-yl)-3,3,3-trifluoropropan-1-one |
| SMILES | O=C(CC(F)(F)F)N1CCC(Cl)C1 |
| InChI | InChI=1S/C7H9ClF3NO/c8-5-1-2-12(4-5)6(13)3-7(9,10)11/h5H,1-4H2 |
| InChIKey | PNEDJHSITSQSSW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.60 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|