C8H13F3N2OS — CID 119373587
1-(4-aminopiperidin-1-yl)-2-(trifluoromethylsulfanyl)ethanone (PubChem CID 119373587) has the molecular formula C8H13F3N2OS and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-(4-aminopiperidin-1-yl)-2-(trifluoromethylsulfanyl)ethanone.
| Compound Name | 1-(4-aminopiperidin-1-yl)-2-(trifluoromethylsulfanyl)ethanone |
|---|---|
| PubChem CID | 119373587 |
| Molecular Formula | C8H13F3N2OS |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 1-(4-aminopiperidin-1-yl)-2-(trifluoromethylsulfanyl)ethanone |
| SMILES | NC1CCN(C(=O)CSC(F)(F)F)CC1 |
| InChI | InChI=1S/C8H13F3N2OS/c9-8(10,11)15-5-7(14)13-3-1-6(12)2-4-13/h6H,1-5,12H2 |
| InChIKey | GSRUXGGJUPYGTP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |