C12H19F3N2OS — CID 119622325
1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2-(trifluoromethylsulfanyl)ethanone (PubChem CID 119622325) has the molecular formula C12H19F3N2OS and a molecular weight of 296.36 g/mol. Its IUPAC name is 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2-(trifluoromethylsulfanyl)ethanone.
| Compound Name | 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2-(trifluoromethylsulfanyl)ethanone |
|---|---|
| PubChem CID | 119622325 |
| Molecular Formula | C12H19F3N2OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2-(trifluoromethylsulfanyl)ethanone |
| SMILES | O=C(CSC(F)(F)F)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C12H19F3N2OS/c13-12(14,15)19-8-11(18)17-5-3-10(4-6-17)16-7-9-1-2-9/h9-10,16H,1-8H2 |
| InChIKey | QBWKERIHRNPLOE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |