C14H24F2N2O2 — CID 103209701
1-[4-(cyclopropylmethylamino)piperidin-1-yl]-3-(2,2-difluoroethoxy)propan-1-one (PubChem CID 103209701) has the molecular formula C14H24F2N2O2 and a molecular weight of 290.35 g/mol. Its IUPAC name is 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-3-(2,2-difluoroethoxy)propan-1-one.
| Compound Name | 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-3-(2,2-difluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103209701 |
| Molecular Formula | C14H24F2N2O2 |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-3-(2,2-difluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)F)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C14H24F2N2O2/c15-13(16)10-20-8-5-14(19)18-6-3-12(4-7-18)17-9-11-1-2-11/h11-13,17H,1-10H2 |
| InChIKey | YJFFQWJLCSVKKU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|