C17H30ClN3O2 — CID 119623305
N-[4-[4-(cyclopropylmethylamino)piperidin-1-yl]-4-oxobutyl]cyclopropanecarboxamide;hydrochloride (PubChem CID 119623305) has the molecular formula C17H30ClN3O2 and a molecular weight of 343.90 g/mol. Its IUPAC name is N-[4-[4-(cyclopropylmethylamino)piperidin-1-yl]-4-oxobutyl]cyclopropanecarboxamide;hydrochloride.
| Compound Name | N-[4-[4-(cyclopropylmethylamino)piperidin-1-yl]-4-oxobutyl]cyclopropanecarboxamide;hydrochloride |
|---|---|
| PubChem CID | 119623305 |
| Molecular Formula | C17H30ClN3O2 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | N-[4-[4-(cyclopropylmethylamino)piperidin-1-yl]-4-oxobutyl]cyclopropanecarboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCC(=O)N1CCC(NCC2CC2)CC1)C1CC1 |
| InChI | InChI=1S/C17H29N3O2.ClH/c21-16(2-1-9-18-17(22)14-5-6-14)20-10-7-15(8-11-20)19-12-13-3-4-13;/h13-15,19H,1-12H2,(H,18,22);1H |
| InChIKey | BJBLYWJYXZHTHX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|