C19H27Cl3N2O2 — CID 119624379
1-[4-(cyclopropylmethylamino)piperidin-1-yl]-4-(2,3-dichlorophenoxy)butan-1-one;hydrochloride (PubChem CID 119624379) has the molecular formula C19H27Cl3N2O2 and a molecular weight of 421.80 g/mol. Its IUPAC name is 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-4-(2,3-dichlorophenoxy)butan-1-one;hydrochloride.
| Compound Name | 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-4-(2,3-dichlorophenoxy)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119624379 |
| Molecular Formula | C19H27Cl3N2O2 |
| Molecular Weight | 421.80 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-4-(2,3-dichlorophenoxy)butan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCCOc1cccc(Cl)c1Cl)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C19H26Cl2N2O2.ClH/c20-16-3-1-4-17(19(16)21)25-12-2-5-18(24)23-10-8-15(9-11-23)22-13-14-6-7-14;/h1,3-4,14-15,22H,2,5-13H2;1H |
| InChIKey | ADFGBKFENSHCBS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.80 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|