C10H18ClF3N2OS — CID 119517514
1-[4-(1-aminoethyl)piperidin-1-yl]-2-(trifluoromethylsulfanyl)ethanone;hydrochloride (PubChem CID 119517514) has the molecular formula C10H18ClF3N2OS and a molecular weight of 306.78 g/mol. Its IUPAC name is 1-[4-(1-aminoethyl)piperidin-1-yl]-2-(trifluoromethylsulfanyl)ethanone;hydrochloride.
| Compound Name | 1-[4-(1-aminoethyl)piperidin-1-yl]-2-(trifluoromethylsulfanyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119517514 |
| Molecular Formula | C10H18ClF3N2OS |
| Molecular Weight | 306.78 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 1-[4-(1-aminoethyl)piperidin-1-yl]-2-(trifluoromethylsulfanyl)ethanone;hydrochloride |
| SMILES | CC(N)C1CCN(C(=O)CSC(F)(F)F)CC1.Cl |
| InChI | InChI=1S/C10H17F3N2OS.ClH/c1-7(14)8-2-4-15(5-3-8)9(16)6-17-10(11,12)13;/h7-8H,2-6,14H2,1H3;1H |
| InChIKey | VWDAGGQEUAKUMT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.78 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |