C10H12ClF6NO — CID 103311097
1-[3-(2-chloroethyl)pyrrolidin-1-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-one (PubChem CID 103311097) has the molecular formula C10H12ClF6NO and a molecular weight of 311.65 g/mol. Its IUPAC name is 1-[3-(2-chloroethyl)pyrrolidin-1-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-one.
| Compound Name | 1-[3-(2-chloroethyl)pyrrolidin-1-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-one |
|---|---|
| PubChem CID | 103311097 |
| Molecular Formula | C10H12ClF6NO |
| Molecular Weight | 311.65 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 1-[3-(2-chloroethyl)pyrrolidin-1-yl]-3,3,3-trifluoro-2-(trifluoromethyl)propan-1-one |
| SMILES | O=C(C(C(F)(F)F)C(F)(F)F)N1CCC(CCCl)C1 |
| InChI | InChI=1S/C10H12ClF6NO/c11-3-1-6-2-4-18(5-6)8(19)7(9(12,13)14)10(15,16)17/h6-7H,1-5H2 |
| InChIKey | RHPJNENSGJDMCD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|