C7H14F3N3O2S — CID 175025436
N,N-dimethyl-3-(trifluoromethyl)piperazine-1-sulfonamide (PubChem CID 175025436) has the molecular formula C7H14F3N3O2S and a molecular weight of 261.27 g/mol. Its IUPAC name is N,N-dimethyl-3-(trifluoromethyl)piperazine-1-sulfonamide.
| Compound Name | N,N-dimethyl-3-(trifluoromethyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 175025436 |
| Molecular Formula | C7H14F3N3O2S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N,N-dimethyl-3-(trifluoromethyl)piperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCNC(C(F)(F)F)C1 |
| InChI | InChI=1S/C7H14F3N3O2S/c1-12(2)16(14,15)13-4-3-11-6(5-13)7(8,9)10/h6,11H,3-5H2,1-2H3 |
| InChIKey | OTPJUNHNEMAEBS-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |