C11H23N3O2S — CID 115269628
N,N-dimethyl-4-pyrrolidin-3-ylpiperidine-1-sulfonamide (PubChem CID 115269628) has the molecular formula C11H23N3O2S and a molecular weight of 261.39 g/mol. Its IUPAC name is N,N-dimethyl-4-pyrrolidin-3-ylpiperidine-1-sulfonamide.
| Compound Name | N,N-dimethyl-4-pyrrolidin-3-ylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 115269628 |
| Molecular Formula | C11H23N3O2S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N,N-dimethyl-4-pyrrolidin-3-ylpiperidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC(C2CCNC2)CC1 |
| InChI | InChI=1S/C11H23N3O2S/c1-13(2)17(15,16)14-7-4-10(5-8-14)11-3-6-12-9-11/h10-12H,3-9H2,1-2H3 |
| InChIKey | WUYFFSIAMADITL-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |