C15H21ClF2N2O2S — CID 146064617
1-(3,5-difluorophenyl)sulfonyl-4-pyrrolidin-3-ylpiperidine;hydrochloride (PubChem CID 146064617) has the molecular formula C15H21ClF2N2O2S and a molecular weight of 366.86 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)sulfonyl-4-pyrrolidin-3-ylpiperidine;hydrochloride.
| Compound Name | 1-(3,5-difluorophenyl)sulfonyl-4-pyrrolidin-3-ylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 146064617 |
| Molecular Formula | C15H21ClF2N2O2S |
| Molecular Weight | 366.86 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 1-(3,5-difluorophenyl)sulfonyl-4-pyrrolidin-3-ylpiperidine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cc(F)cc(F)c1)N1CCC(C2CCNC2)CC1 |
| InChI | InChI=1S/C15H20F2N2O2S.ClH/c16-13-7-14(17)9-15(8-13)22(20,21)19-5-2-11(3-6-19)12-1-4-18-10-12;/h7-9,11-12,18H,1-6,10H2;1H |
| InChIKey | GQEQIGYPWXBLGX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.86 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |