C11H11F2NO3S — CID 150339337
1-(3,5-difluorophenyl)sulfonylpiperidin-4-one (PubChem CID 150339337) has the molecular formula C11H11F2NO3S and a molecular weight of 275.28 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)sulfonylpiperidin-4-one.
| Compound Name | 1-(3,5-difluorophenyl)sulfonylpiperidin-4-one |
|---|---|
| PubChem CID | 150339337 |
| Molecular Formula | C11H11F2NO3S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 1-(3,5-difluorophenyl)sulfonylpiperidin-4-one |
| SMILES | O=C1CCN(S(=O)(=O)c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C11H11F2NO3S/c12-8-5-9(13)7-11(6-8)18(16,17)14-3-1-10(15)2-4-14/h5-7H,1-4H2 |
| InChIKey | GRJDSDVYDMXTRV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |